C10H15ClN6 — CID 66193323
N-[[1-[(5-chloro-1-methylimidazol-2-yl)methyl]triazol-4-yl]methyl]ethanamine (PubChem CID 66193323) has the molecular formula C10H15ClN6 and a molecular weight of 254.72 g/mol. Its IUPAC name is N-[[1-[(5-chloro-1-methylimidazol-2-yl)methyl]triazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(5-chloro-1-methylimidazol-2-yl)methyl]triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66193323 |
| Molecular Formula | C10H15ClN6 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | N-[[1-[(5-chloro-1-methylimidazol-2-yl)methyl]triazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn(Cc2ncc(Cl)n2C)nn1 |
| InChI | InChI=1S/C10H15ClN6/c1-3-12-4-8-6-17(15-14-8)7-10-13-5-9(11)16(10)2/h5-6,12H,3-4,7H2,1-2H3 |
| InChIKey | VYYVWMFJEKWJMF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |