C10H13ClN4S — CID 66194460
N-[[1-[(5-chlorothiophen-2-yl)methyl]triazol-4-yl]methyl]ethanamine (PubChem CID 66194460) has the molecular formula C10H13ClN4S and a molecular weight of 256.76 g/mol. Its IUPAC name is N-[[1-[(5-chlorothiophen-2-yl)methyl]triazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(5-chlorothiophen-2-yl)methyl]triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66194460 |
| Molecular Formula | C10H13ClN4S |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-[[1-[(5-chlorothiophen-2-yl)methyl]triazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn(Cc2ccc(Cl)s2)nn1 |
| InChI | InChI=1S/C10H13ClN4S/c1-2-12-5-8-6-15(14-13-8)7-9-3-4-10(11)16-9/h3-4,6,12H,2,5,7H2,1H3 |
| InChIKey | HXWAKPBABSPAJO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |