C12H19N5S — CID 106012253
2-[4-[[(5-ethylthiophen-2-yl)methylamino]methyl]triazol-1-yl]ethanamine (PubChem CID 106012253) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 2-[4-[[(5-ethylthiophen-2-yl)methylamino]methyl]triazol-1-yl]ethanamine.
| Compound Name | 2-[4-[[(5-ethylthiophen-2-yl)methylamino]methyl]triazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 106012253 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-[4-[[(5-ethylthiophen-2-yl)methylamino]methyl]triazol-1-yl]ethanamine |
| SMILES | CCc1ccc(CNCc2cn(CCN)nn2)s1 |
| InChI | InChI=1S/C12H19N5S/c1-2-11-3-4-12(18-11)8-14-7-10-9-17(6-5-13)16-15-10/h3-4,9,14H,2,5-8,13H2,1H3 |
| InChIKey | XOKWCRIRNUPUHI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |