C9H16N2S — CID 62142433
N'-[(5-ethylthiophen-2-yl)methyl]ethane-1,2-diamine (PubChem CID 62142433) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N'-[(5-ethylthiophen-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(5-ethylthiophen-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62142433 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N'-[(5-ethylthiophen-2-yl)methyl]ethane-1,2-diamine |
| SMILES | CCc1ccc(CNCCN)s1 |
| InChI | InChI=1S/C9H16N2S/c1-2-8-3-4-9(12-8)7-11-6-5-10/h3-4,11H,2,5-7,10H2,1H3 |
| InChIKey | RPZLEFBFGQIZFW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|