C11H20N2O2S2 — CID 114175013
2-[(5-ethylthiophen-2-yl)methylamino]-N,N-dimethylethanesulfonamide (PubChem CID 114175013) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-[(5-ethylthiophen-2-yl)methylamino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(5-ethylthiophen-2-yl)methylamino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 114175013 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[(5-ethylthiophen-2-yl)methylamino]-N,N-dimethylethanesulfonamide |
| SMILES | CCc1ccc(CNCCS(=O)(=O)N(C)C)s1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-4-10-5-6-11(16-10)9-12-7-8-17(14,15)13(2)3/h5-6,12H,4,7-9H2,1-3H3 |
| InChIKey | BITDUSWJDZZMJJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|