C13H24N2O2S2 — CID 106335429
2-[(5-tert-butylthiophen-2-yl)methylamino]-N,N-dimethylethanesulfonamide (PubChem CID 106335429) has the molecular formula C13H24N2O2S2 and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-[(5-tert-butylthiophen-2-yl)methylamino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(5-tert-butylthiophen-2-yl)methylamino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106335429 |
| Molecular Formula | C13H24N2O2S2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[(5-tert-butylthiophen-2-yl)methylamino]-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNCc1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C13H24N2O2S2/c1-13(2,3)12-7-6-11(18-12)10-14-8-9-19(16,17)15(4)5/h6-7,14H,8-10H2,1-5H3 |
| InChIKey | AWIGONIXTPLLKN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|