C14H25NS2 — CID 123291785
N-[(5-tert-butylthiophen-2-yl)methyl]-2-propan-2-ylsulfanylethanamine (PubChem CID 123291785) has the molecular formula C14H25NS2 and a molecular weight of 271.49 g/mol. Its IUPAC name is N-[(5-tert-butylthiophen-2-yl)methyl]-2-propan-2-ylsulfanylethanamine.
| Compound Name | N-[(5-tert-butylthiophen-2-yl)methyl]-2-propan-2-ylsulfanylethanamine |
|---|---|
| PubChem CID | 123291785 |
| Molecular Formula | C14H25NS2 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[(5-tert-butylthiophen-2-yl)methyl]-2-propan-2-ylsulfanylethanamine |
| SMILES | CC(C)SCCNCc1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C14H25NS2/c1-11(2)16-9-8-15-10-12-6-7-13(17-12)14(3,4)5/h6-7,11,15H,8-10H2,1-5H3 |
| InChIKey | DVKOYFJZTXINCD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|