C13H21NS — CID 115742295
N-[(5-tert-butylthiophen-2-yl)methyl]but-3-en-2-amine (PubChem CID 115742295) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is N-[(5-tert-butylthiophen-2-yl)methyl]but-3-en-2-amine.
| Compound Name | N-[(5-tert-butylthiophen-2-yl)methyl]but-3-en-2-amine |
|---|---|
| PubChem CID | 115742295 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-[(5-tert-butylthiophen-2-yl)methyl]but-3-en-2-amine |
| SMILES | C=CC(C)NCc1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C13H21NS/c1-6-10(2)14-9-11-7-8-12(15-11)13(3,4)5/h6-8,10,14H,1,9H2,2-5H3 |
| InChIKey | KCCBAEPXCFBKAS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|