C14H25NO2S — CID 103816323
3-[(5-tert-butylthiophen-2-yl)methylamino]-4-methoxybutan-1-ol (PubChem CID 103816323) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is 3-[(5-tert-butylthiophen-2-yl)methylamino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(5-tert-butylthiophen-2-yl)methylamino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 103816323 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-[(5-tert-butylthiophen-2-yl)methylamino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)NCc1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C14H25NO2S/c1-14(2,3)13-6-5-12(18-13)9-15-11(7-8-16)10-17-4/h5-6,11,15-16H,7-10H2,1-4H3 |
| InChIKey | BFXGEJJXKIVPBP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |