C12H19NO5 — CID 103923151
methyl 3-[[(4-hydroxy-1-methoxybutan-2-yl)amino]methyl]furan-2-carboxylate (PubChem CID 103923151) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl 3-[[(4-hydroxy-1-methoxybutan-2-yl)amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[(4-hydroxy-1-methoxybutan-2-yl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103923151 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | methyl 3-[[(4-hydroxy-1-methoxybutan-2-yl)amino]methyl]furan-2-carboxylate |
| SMILES | COCC(CCO)NCc1ccoc1C(=O)OC |
| InChI | InChI=1S/C12H19NO5/c1-16-8-10(3-5-14)13-7-9-4-6-18-11(9)12(15)17-2/h4,6,10,13-14H,3,5,7-8H2,1-2H3 |
| InChIKey | DGFFMBRVRHNMLB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |