C12H20N2O3 — CID 82945092
methyl 3-[[1-(dimethylamino)propan-2-ylamino]methyl]furan-2-carboxylate (PubChem CID 82945092) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl 3-[[1-(dimethylamino)propan-2-ylamino]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[1-(dimethylamino)propan-2-ylamino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 82945092 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl 3-[[1-(dimethylamino)propan-2-ylamino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNC(C)CN(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-9(8-14(2)3)13-7-10-5-6-17-11(10)12(15)16-4/h5-6,9,13H,7-8H2,1-4H3 |
| InChIKey | SNYMJRJREGVKQI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |