C11H17NO4 — CID 103923910
methyl 3-[[[(2R)-4-hydroxybutan-2-yl]amino]methyl]furan-2-carboxylate (PubChem CID 103923910) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 3-[[[(2R)-4-hydroxybutan-2-yl]amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[[(2R)-4-hydroxybutan-2-yl]amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103923910 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | methyl 3-[[[(2R)-4-hydroxybutan-2-yl]amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CN[C@H](C)CCO |
| InChI | InChI=1S/C11H17NO4/c1-8(3-5-13)12-7-9-4-6-16-10(9)11(14)15-2/h4,6,8,12-13H,3,5,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | DIDGMKUCXHROOO-MRVPVSSYSA-N |
| XLogP | 0.93 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |