C12H18N2S — CID 106012225
N'-[(5-ethylthiophen-2-yl)methyl]-N-prop-2-ynylethane-1,2-diamine (PubChem CID 106012225) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is N'-[(5-ethylthiophen-2-yl)methyl]-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | N'-[(5-ethylthiophen-2-yl)methyl]-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 106012225 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N'-[(5-ethylthiophen-2-yl)methyl]-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNCCNCc1ccc(CC)s1 |
| InChI | InChI=1S/C12H18N2S/c1-3-7-13-8-9-14-10-12-6-5-11(4-2)15-12/h1,5-6,13-14H,4,7-10H2,2H3 |
| InChIKey | SSTHUPDEWFZXRI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|