C14H24N2O2S — CID 106335225
N,N-dimethyl-2-[(4-propan-2-ylphenyl)methylamino]ethanesulfonamide (PubChem CID 106335225) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is N,N-dimethyl-2-[(4-propan-2-ylphenyl)methylamino]ethanesulfonamide.
| Compound Name | N,N-dimethyl-2-[(4-propan-2-ylphenyl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 106335225 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N,N-dimethyl-2-[(4-propan-2-ylphenyl)methylamino]ethanesulfonamide |
| SMILES | CC(C)c1ccc(CNCCS(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C14H24N2O2S/c1-12(2)14-7-5-13(6-8-14)11-15-9-10-19(17,18)16(3)4/h5-8,12,15H,9-11H2,1-4H3 |
| InChIKey | QXTICRNELCPBKW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|