C12H19N3O4S — CID 106335376
N,N-dimethyl-2-[(4-methyl-3-nitrophenyl)methylamino]ethanesulfonamide (PubChem CID 106335376) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[(4-methyl-3-nitrophenyl)methylamino]ethanesulfonamide.
| Compound Name | N,N-dimethyl-2-[(4-methyl-3-nitrophenyl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 106335376 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N,N-dimethyl-2-[(4-methyl-3-nitrophenyl)methylamino]ethanesulfonamide |
| SMILES | Cc1ccc(CNCCS(=O)(=O)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N3O4S/c1-10-4-5-11(8-12(10)15(16)17)9-13-6-7-20(18,19)14(2)3/h4-5,8,13H,6-7,9H2,1-3H3 |
| InChIKey | VQJOEMMHNYGCMI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|