C11H17N3O4S — CID 106335309
N,N-dimethyl-2-[(3-nitrophenyl)methylamino]ethanesulfonamide (PubChem CID 106335309) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is N,N-dimethyl-2-[(3-nitrophenyl)methylamino]ethanesulfonamide.
| Compound Name | N,N-dimethyl-2-[(3-nitrophenyl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 106335309 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N,N-dimethyl-2-[(3-nitrophenyl)methylamino]ethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H17N3O4S/c1-13(2)19(17,18)7-6-12-9-10-4-3-5-11(8-10)14(15)16/h3-5,8,12H,6-7,9H2,1-2H3 |
| InChIKey | CITKDNUAKDLABT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|