C11H16BrClN2O2S — CID 106335652
2-[(4-bromo-3-chlorophenyl)methylamino]-N,N-dimethylethanesulfonamide (PubChem CID 106335652) has the molecular formula C11H16BrClN2O2S and a molecular weight of 355.69 g/mol. Its IUPAC name is 2-[(4-bromo-3-chlorophenyl)methylamino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(4-bromo-3-chlorophenyl)methylamino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106335652 |
| Molecular Formula | C11H16BrClN2O2S |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2-[(4-bromo-3-chlorophenyl)methylamino]-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNCc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C11H16BrClN2O2S/c1-15(2)18(16,17)6-5-14-8-9-3-4-10(12)11(13)7-9/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | ZDBLCBPKEJHIMG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|