C12H20N2O4S — CID 106335720
2-[(4-hydroxy-3-methoxyphenyl)methylamino]-N,N-dimethylethanesulfonamide (PubChem CID 106335720) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-methoxyphenyl)methylamino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(4-hydroxy-3-methoxyphenyl)methylamino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106335720 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[(4-hydroxy-3-methoxyphenyl)methylamino]-N,N-dimethylethanesulfonamide |
| SMILES | COc1cc(CNCCS(=O)(=O)N(C)C)ccc1O |
| InChI | InChI=1S/C12H20N2O4S/c1-14(2)19(16,17)7-6-13-9-10-4-5-11(15)12(8-10)18-3/h4-5,8,13,15H,6-7,9H2,1-3H3 |
| InChIKey | MXSUKVVFIJMMLL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|