C11H16BrClFN — CID 142451886
N-[(4-bromo-3-chlorophenyl)methyl]propan-1-amine;fluoromethane (PubChem CID 142451886) has the molecular formula C11H16BrClFN and a molecular weight of 296.61 g/mol. Its IUPAC name is N-[(4-bromo-3-chlorophenyl)methyl]propan-1-amine;fluoromethane.
| Compound Name | N-[(4-bromo-3-chlorophenyl)methyl]propan-1-amine;fluoromethane |
|---|---|
| PubChem CID | 142451886 |
| Molecular Formula | C11H16BrClFN |
| Molecular Weight | 296.61 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | N-[(4-bromo-3-chlorophenyl)methyl]propan-1-amine;fluoromethane |
| SMILES | CCCNCc1ccc(Br)c(Cl)c1.CF |
| InChI | InChI=1S/C10H13BrClN.CH3F/c1-2-5-13-7-8-3-4-9(11)10(12)6-8;1-2/h3-4,6,13H,2,5,7H2,1H3;1H3 |
| InChIKey | IBZXSUSLKIHIEX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|