C14H21BrClNO — CID 106251907
2-[[(4-bromo-3-chlorophenyl)methylamino]methyl]-2-ethylbutan-1-ol (PubChem CID 106251907) has the molecular formula C14H21BrClNO and a molecular weight of 334.69 g/mol. Its IUPAC name is 2-[[(4-bromo-3-chlorophenyl)methylamino]methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[[(4-bromo-3-chlorophenyl)methylamino]methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 106251907 |
| Molecular Formula | C14H21BrClNO |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-[[(4-bromo-3-chlorophenyl)methylamino]methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)CNCc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C14H21BrClNO/c1-3-14(4-2,10-18)9-17-8-11-5-6-12(15)13(16)7-11/h5-7,17-18H,3-4,8-10H2,1-2H3 |
| InChIKey | CHMQKVDRNLGYBV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |