C14H20Cl3NO — CID 106252162
2-ethyl-2-[[(2,3,6-trichlorophenyl)methylamino]methyl]butan-1-ol (PubChem CID 106252162) has the molecular formula C14H20Cl3NO and a molecular weight of 324.68 g/mol. Its IUPAC name is 2-ethyl-2-[[(2,3,6-trichlorophenyl)methylamino]methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[[(2,3,6-trichlorophenyl)methylamino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 106252162 |
| Molecular Formula | C14H20Cl3NO |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-ethyl-2-[[(2,3,6-trichlorophenyl)methylamino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl3NO/c1-3-14(4-2,9-19)8-18-7-10-11(15)5-6-12(16)13(10)17/h5-6,18-19H,3-4,7-9H2,1-2H3 |
| InChIKey | QGCXAIMUXMIDDJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|