C15H24ClNO — CID 106256109
2-[[(2-chloro-4-methylphenyl)methylamino]methyl]-2-ethylbutan-1-ol (PubChem CID 106256109) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 2-[[(2-chloro-4-methylphenyl)methylamino]methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[[(2-chloro-4-methylphenyl)methylamino]methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 106256109 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[[(2-chloro-4-methylphenyl)methylamino]methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)CNCc1ccc(C)cc1Cl |
| InChI | InChI=1S/C15H24ClNO/c1-4-15(5-2,11-18)10-17-9-13-7-6-12(3)8-14(13)16/h6-8,17-18H,4-5,9-11H2,1-3H3 |
| InChIKey | ZIGQDNCCCRVKDL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |