C12H16Cl3NO — CID 115623308
1-[(2,3,6-trichlorophenyl)methylamino]pentan-2-ol (PubChem CID 115623308) has the molecular formula C12H16Cl3NO and a molecular weight of 296.62 g/mol. Its IUPAC name is 1-[(2,3,6-trichlorophenyl)methylamino]pentan-2-ol.
| Compound Name | 1-[(2,3,6-trichlorophenyl)methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 115623308 |
| Molecular Formula | C12H16Cl3NO |
| Molecular Weight | 296.62 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 1-[(2,3,6-trichlorophenyl)methylamino]pentan-2-ol |
| SMILES | CCCC(O)CNCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl3NO/c1-2-3-8(17)6-16-7-9-10(13)4-5-11(14)12(9)15/h4-5,8,16-17H,2-3,6-7H2,1H3 |
| InChIKey | MMDKSCBOGVIZTL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|