C13H18Cl3NO — CID 115719278
1-[1-(2,3,4-trichlorophenyl)ethylamino]pentan-2-ol (PubChem CID 115719278) has the molecular formula C13H18Cl3NO and a molecular weight of 310.65 g/mol. Its IUPAC name is 1-[1-(2,3,4-trichlorophenyl)ethylamino]pentan-2-ol.
| Compound Name | 1-[1-(2,3,4-trichlorophenyl)ethylamino]pentan-2-ol |
|---|---|
| PubChem CID | 115719278 |
| Molecular Formula | C13H18Cl3NO |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 1-[1-(2,3,4-trichlorophenyl)ethylamino]pentan-2-ol |
| SMILES | CCCC(O)CNC(C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl3NO/c1-3-4-9(18)7-17-8(2)10-5-6-11(14)13(16)12(10)15/h5-6,8-9,17-18H,3-4,7H2,1-2H3 |
| InChIKey | KTEXVXDMAPKEGE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|