C14H20Cl3N — CID 63452553
4-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]pentan-1-amine (PubChem CID 63452553) has the molecular formula C14H20Cl3N and a molecular weight of 308.68 g/mol. Its IUPAC name is 4-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]pentan-1-amine.
| Compound Name | 4-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 63452553 |
| Molecular Formula | C14H20Cl3N |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]pentan-1-amine |
| SMILES | CC(C)CCCNC(C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl3N/c1-9(2)5-4-8-18-10(3)11-6-7-12(15)14(17)13(11)16/h6-7,9-10,18H,4-5,8H2,1-3H3 |
| InChIKey | PBFZVRGPUBUJBQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|