C16H15Cl3FN — CID 43760653
N-[2-(2-fluorophenyl)ethyl]-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 43760653) has the molecular formula C16H15Cl3FN and a molecular weight of 346.66 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-1-(2,3,4-trichlorophenyl)ethanamine.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-1-(2,3,4-trichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 43760653 |
| Molecular Formula | C16H15Cl3FN |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | CC(NCCc1ccccc1F)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl3FN/c1-10(12-6-7-13(17)16(19)15(12)18)21-9-8-11-4-2-3-5-14(11)20/h2-7,10,21H,8-9H2,1H3 |
| InChIKey | DAJIROZKXVEPCE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|