C14H15Cl3N2S — CID 106038911
N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 106038911) has the molecular formula C14H15Cl3N2S and a molecular weight of 349.71 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1-(2,3,4-trichlorophenyl)ethanamine.
| Compound Name | N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1-(2,3,4-trichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 106038911 |
| Molecular Formula | C14H15Cl3N2S |
| Molecular Weight | 349.71 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | Cc1nc(CCNC(C)c2ccc(Cl)c(Cl)c2Cl)cs1 |
| InChI | InChI=1S/C14H15Cl3N2S/c1-8(11-3-4-12(15)14(17)13(11)16)18-6-5-10-7-20-9(2)19-10/h3-4,7-8,18H,5-6H2,1-2H3 |
| InChIKey | TYANBPBDDQVSRK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.71 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|