C15H20N2O2S — CID 103913810
4-methoxy-2-[1-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]ethyl]phenol (PubChem CID 103913810) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-methoxy-2-[1-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]ethyl]phenol.
| Compound Name | 4-methoxy-2-[1-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]ethyl]phenol |
|---|---|
| PubChem CID | 103913810 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-methoxy-2-[1-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]ethyl]phenol |
| SMILES | COc1ccc(O)c(C(C)NCCc2csc(C)n2)c1 |
| InChI | InChI=1S/C15H20N2O2S/c1-10(14-8-13(19-3)4-5-15(14)18)16-7-6-12-9-20-11(2)17-12/h4-5,8-10,16,18H,6-7H2,1-3H3 |
| InChIKey | MVOJIDXDDJRTPO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|