C13H19Cl3N2 — CID 43764699
N',N'-dimethyl-N-[1-(2,3,4-trichlorophenyl)ethyl]propane-1,3-diamine (PubChem CID 43764699) has the molecular formula C13H19Cl3N2 and a molecular weight of 309.67 g/mol. Its IUPAC name is N',N'-dimethyl-N-[1-(2,3,4-trichlorophenyl)ethyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[1-(2,3,4-trichlorophenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 43764699 |
| Molecular Formula | C13H19Cl3N2 |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N',N'-dimethyl-N-[1-(2,3,4-trichlorophenyl)ethyl]propane-1,3-diamine |
| SMILES | CC(NCCCN(C)C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H19Cl3N2/c1-9(17-7-4-8-18(2)3)10-5-6-11(14)13(16)12(10)15/h5-6,9,17H,4,7-8H2,1-3H3 |
| InChIKey | LQMLTRXQWFDUGT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|