C15H23Cl3N2 — CID 106040177
N'-methyl-N'-propan-2-yl-N-[1-(2,3,4-trichlorophenyl)ethyl]propane-1,3-diamine (PubChem CID 106040177) has the molecular formula C15H23Cl3N2 and a molecular weight of 337.72 g/mol. Its IUPAC name is N'-methyl-N'-propan-2-yl-N-[1-(2,3,4-trichlorophenyl)ethyl]propane-1,3-diamine.
| Compound Name | N'-methyl-N'-propan-2-yl-N-[1-(2,3,4-trichlorophenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 106040177 |
| Molecular Formula | C15H23Cl3N2 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N'-methyl-N'-propan-2-yl-N-[1-(2,3,4-trichlorophenyl)ethyl]propane-1,3-diamine |
| SMILES | CC(NCCCN(C)C(C)C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H23Cl3N2/c1-10(2)20(4)9-5-8-19-11(3)12-6-7-13(16)15(18)14(12)17/h6-7,10-11,19H,5,8-9H2,1-4H3 |
| InChIKey | KAVAIKRHMKHYCT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|