C16H26BrFN2 — CID 82964773
N-[1-(4-bromo-2-fluorophenyl)ethyl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine (PubChem CID 82964773) has the molecular formula C16H26BrFN2 and a molecular weight of 345.30 g/mol. Its IUPAC name is N-[1-(4-bromo-2-fluorophenyl)ethyl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine.
| Compound Name | N-[1-(4-bromo-2-fluorophenyl)ethyl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 82964773 |
| Molecular Formula | C16H26BrFN2 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[1-(4-bromo-2-fluorophenyl)ethyl]-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
| SMILES | CC(NCCCCN(C)C(C)C)c1ccc(Br)cc1F |
| InChI | InChI=1S/C16H26BrFN2/c1-12(2)20(4)10-6-5-9-19-13(3)15-8-7-14(17)11-16(15)18/h7-8,11-13,19H,5-6,9-10H2,1-4H3 |
| InChIKey | YLQFCRFXNUCGEE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|