C12H13Cl3N4 — CID 103907067
N-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 103907067) has the molecular formula C12H13Cl3N4 and a molecular weight of 319.62 g/mol. Its IUPAC name is N-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine.
| Compound Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 103907067 |
| Molecular Formula | C12H13Cl3N4 |
| Molecular Weight | 319.62 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | CC(NCc1ncn(C)n1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl3N4/c1-7(16-5-10-17-6-19(2)18-10)8-3-4-9(13)12(15)11(8)14/h3-4,6-7,16H,5H2,1-2H3 |
| InChIKey | DOAHITYEWVIDTQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|