C8H9Cl3N2 — CID 53402187
1-(2,3,4-trichlorophenyl)ethylhydrazine (PubChem CID 53402187) has the molecular formula C8H9Cl3N2 and a molecular weight of 239.53 g/mol. Its IUPAC name is 1-(2,3,4-trichlorophenyl)ethylhydrazine.
| Compound Name | 1-(2,3,4-trichlorophenyl)ethylhydrazine |
|---|---|
| PubChem CID | 53402187 |
| Molecular Formula | C8H9Cl3N2 |
| Molecular Weight | 239.53 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 1-(2,3,4-trichlorophenyl)ethylhydrazine |
| SMILES | CC(NN)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H9Cl3N2/c1-4(13-12)5-2-3-6(9)8(11)7(5)10/h2-4,13H,12H2,1H3 |
| InChIKey | XRSAQIGVSNJCEU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|