C14H10Cl4FN — CID 43775999
5-chloro-2-fluoro-N-[1-(2,3,4-trichlorophenyl)ethyl]aniline (PubChem CID 43775999) has the molecular formula C14H10Cl4FN and a molecular weight of 353.05 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[1-(2,3,4-trichlorophenyl)ethyl]aniline.
| Compound Name | 5-chloro-2-fluoro-N-[1-(2,3,4-trichlorophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43775999 |
| Molecular Formula | C14H10Cl4FN |
| Molecular Weight | 353.05 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 5-chloro-2-fluoro-N-[1-(2,3,4-trichlorophenyl)ethyl]aniline |
| SMILES | CC(Nc1cc(Cl)ccc1F)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl4FN/c1-7(9-3-4-10(16)14(18)13(9)17)20-12-6-8(15)2-5-11(12)19/h2-7,20H,1H3 |
| InChIKey | RNKJTHJFAREOMJ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.05 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|