C14H10Cl3F2N — CID 43716586
4-chloro-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-fluoroaniline (PubChem CID 43716586) has the molecular formula C14H10Cl3F2N and a molecular weight of 336.60 g/mol. Its IUPAC name is 4-chloro-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-fluoroaniline.
| Compound Name | 4-chloro-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 43716586 |
| Molecular Formula | C14H10Cl3F2N |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 4-chloro-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-fluoroaniline |
| SMILES | CC(Nc1ccc(Cl)cc1F)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C14H10Cl3F2N/c1-7(13-9(16)3-4-10(18)14(13)17)20-12-5-2-8(15)6-11(12)19/h2-7,20H,1H3 |
| InChIKey | LSLSMSSKENGFKA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|