C15H13Cl2F2N — CID 63476345
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-4-fluoro-3-methylaniline (PubChem CID 63476345) has the molecular formula C15H13Cl2F2N and a molecular weight of 316.18 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-4-fluoro-3-methylaniline.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-4-fluoro-3-methylaniline |
|---|---|
| PubChem CID | 63476345 |
| Molecular Formula | C15H13Cl2F2N |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-4-fluoro-3-methylaniline |
| SMILES | Cc1cc(NC(C)c2c(Cl)ccc(F)c2Cl)ccc1F |
| InChI | InChI=1S/C15H13Cl2F2N/c1-8-7-10(3-5-12(8)18)20-9(2)14-11(16)4-6-13(19)15(14)17/h3-7,9,20H,1-2H3 |
| InChIKey | YSLHMLXOIVRISK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|