C14H10Cl4FNO — CID 107679459
2,6-dichloro-4-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]phenol (PubChem CID 107679459) has the molecular formula C14H10Cl4FNO and a molecular weight of 369.05 g/mol. Its IUPAC name is 2,6-dichloro-4-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]phenol.
| Compound Name | 2,6-dichloro-4-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]phenol |
|---|---|
| PubChem CID | 107679459 |
| Molecular Formula | C14H10Cl4FNO |
| Molecular Weight | 369.05 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 2,6-dichloro-4-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]phenol |
| SMILES | CC(Nc1cc(Cl)c(O)c(Cl)c1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C14H10Cl4FNO/c1-6(12-8(15)2-3-11(19)13(12)18)20-7-4-9(16)14(21)10(17)5-7/h2-6,20-21H,1H3 |
| InChIKey | KGVJWPNHZYDJKF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.05 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|