C15H14Cl2FNO — CID 43743261
[2-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]phenyl]methanol (PubChem CID 43743261) has the molecular formula C15H14Cl2FNO and a molecular weight of 314.19 g/mol. Its IUPAC name is [2-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]phenyl]methanol.
| Compound Name | [2-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]phenyl]methanol |
|---|---|
| PubChem CID | 43743261 |
| Molecular Formula | C15H14Cl2FNO |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | [2-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]phenyl]methanol |
| SMILES | CC(Nc1ccccc1CO)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H14Cl2FNO/c1-9(14-11(16)6-7-12(18)15(14)17)19-13-5-3-2-4-10(13)8-20/h2-7,9,19-20H,8H2,1H3 |
| InChIKey | ZKZGZSQRBQEUGN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|