C15H13Cl3FN — CID 43545032
3-chloro-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-methylaniline (PubChem CID 43545032) has the molecular formula C15H13Cl3FN and a molecular weight of 332.63 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-methylaniline.
| Compound Name | 3-chloro-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-methylaniline |
|---|---|
| PubChem CID | 43545032 |
| Molecular Formula | C15H13Cl3FN |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 3-chloro-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2-methylaniline |
| SMILES | Cc1c(Cl)cccc1NC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H13Cl3FN/c1-8-10(16)4-3-5-13(8)20-9(2)14-11(17)6-7-12(19)15(14)18/h3-7,9,20H,1-2H3 |
| InChIKey | YZMKKEYZYMYAGC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|