C15H14Cl3N — CID 43095344
3-chloro-N-[1-(2,5-dichlorophenyl)ethyl]-2-methylaniline (PubChem CID 43095344) has the molecular formula C15H14Cl3N and a molecular weight of 314.64 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,5-dichlorophenyl)ethyl]-2-methylaniline.
| Compound Name | 3-chloro-N-[1-(2,5-dichlorophenyl)ethyl]-2-methylaniline |
|---|---|
| PubChem CID | 43095344 |
| Molecular Formula | C15H14Cl3N |
| Molecular Weight | 314.64 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-chloro-N-[1-(2,5-dichlorophenyl)ethyl]-2-methylaniline |
| SMILES | Cc1c(Cl)cccc1NC(C)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H14Cl3N/c1-9-13(17)4-3-5-15(9)19-10(2)12-8-11(16)6-7-14(12)18/h3-8,10,19H,1-2H3 |
| InChIKey | IDKGWJCUDPRGRG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |