C14H13Cl2NO — CID 43100532
3-[1-(2,5-dichlorophenyl)ethylamino]phenol (PubChem CID 43100532) has the molecular formula C14H13Cl2NO and a molecular weight of 282.17 g/mol. Its IUPAC name is 3-[1-(2,5-dichlorophenyl)ethylamino]phenol.
| Compound Name | 3-[1-(2,5-dichlorophenyl)ethylamino]phenol |
|---|---|
| PubChem CID | 43100532 |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 3-[1-(2,5-dichlorophenyl)ethylamino]phenol |
| SMILES | CC(Nc1cccc(O)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2NO/c1-9(13-7-10(15)5-6-14(13)16)17-11-3-2-4-12(18)8-11/h2-9,17-18H,1H3 |
| InChIKey | RTCFCOMVQLMIFL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |