About N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine
N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine (PubChem CID 43721804) has the molecular formula C14H14Cl2N2O
and a molecular weight of 297.19 g/mol. Its IUPAC name is N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine.
Molecular Properties
| Compound Name | N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine |
| PubChem CID | 43721804 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine |
| SMILES | COc1ncccc1NC(C)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O/c1-9(11-8-10(15)5-6-12(11)16)18-13-4-3-7-17-14(13)19-2/h3-9,18H,1-2H3 |
| InChIKey | HDPKIPGRIILTSE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine?
The IUPAC name of N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine (CID 43721804) is N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine.
What is the SMILES notation for N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine?
The canonical SMILES for N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine is COc1ncccc1NC(C)c1cc(Cl)ccc1Cl.
What is the InChIKey of N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine?
The InChIKey is HDPKIPGRIILTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O/c1-9(11-8-10(15)5-6-12(11)16)18-13-4-3-7-17-14(13)19-2/h3-9,18H,1-2H3.
What are the key properties of N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine?
N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine has a molecular weight of 297.19 g/mol, XLogP of 4.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-dichlorophenyl)ethyl]-2-methoxypyridin-3-amine is sourced from PubChem (CID 43721804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).