C15H12Cl2F3N — CID 43103861
N-[1-(2,5-dichlorophenyl)ethyl]-2-(trifluoromethyl)aniline (PubChem CID 43103861) has the molecular formula C15H12Cl2F3N and a molecular weight of 334.17 g/mol. Its IUPAC name is N-[1-(2,5-dichlorophenyl)ethyl]-2-(trifluoromethyl)aniline.
| Compound Name | N-[1-(2,5-dichlorophenyl)ethyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43103861 |
| Molecular Formula | C15H12Cl2F3N |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-[1-(2,5-dichlorophenyl)ethyl]-2-(trifluoromethyl)aniline |
| SMILES | CC(Nc1ccccc1C(F)(F)F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2F3N/c1-9(11-8-10(16)6-7-13(11)17)21-14-5-3-2-4-12(14)15(18,19)20/h2-9,21H,1H3 |
| InChIKey | UBCPCANLRKOLDA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |