C15H14Cl2FNO2 — CID 107678944
2,6-dichloro-4-[1-(3-fluoro-4-methoxyphenyl)ethylamino]phenol (PubChem CID 107678944) has the molecular formula C15H14Cl2FNO2 and a molecular weight of 330.19 g/mol. Its IUPAC name is 2,6-dichloro-4-[1-(3-fluoro-4-methoxyphenyl)ethylamino]phenol.
| Compound Name | 2,6-dichloro-4-[1-(3-fluoro-4-methoxyphenyl)ethylamino]phenol |
|---|---|
| PubChem CID | 107678944 |
| Molecular Formula | C15H14Cl2FNO2 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2,6-dichloro-4-[1-(3-fluoro-4-methoxyphenyl)ethylamino]phenol |
| SMILES | COc1ccc(C(C)Nc2cc(Cl)c(O)c(Cl)c2)cc1F |
| InChI | InChI=1S/C15H14Cl2FNO2/c1-8(9-3-4-14(21-2)13(18)5-9)19-10-6-11(16)15(20)12(17)7-10/h3-8,19-20H,1-2H3 |
| InChIKey | XPQXURZJMBPBOA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|