C15H13Cl3FNO — CID 43126432
2,4,6-trichloro-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]aniline (PubChem CID 43126432) has the molecular formula C15H13Cl3FNO and a molecular weight of 348.63 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43126432 |
| Molecular Formula | C15H13Cl3FNO |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2,4,6-trichloro-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]aniline |
| SMILES | COc1ccc(C(C)Nc2c(Cl)cc(Cl)cc2Cl)cc1F |
| InChI | InChI=1S/C15H13Cl3FNO/c1-8(9-3-4-14(21-2)13(19)5-9)20-15-11(17)6-10(16)7-12(15)18/h3-8,20H,1-2H3 |
| InChIKey | XNXPNSSHNRNZRX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |