C8H6BrCl2F — CID 54578784
2-(1-bromoethyl)-1,3-dichloro-4-fluorobenzene (PubChem CID 54578784) has the molecular formula C8H6BrCl2F and a molecular weight of 271.94 g/mol. Its IUPAC name is 2-(1-bromoethyl)-1,3-dichloro-4-fluorobenzene.
| Compound Name | 2-(1-bromoethyl)-1,3-dichloro-4-fluorobenzene |
|---|---|
| PubChem CID | 54578784 |
| Molecular Formula | C8H6BrCl2F |
| Molecular Weight | 271.94 g/mol |
| Exact Mass | 269.90 |
| IUPAC Name | 2-(1-bromoethyl)-1,3-dichloro-4-fluorobenzene |
| SMILES | CC(Br)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C8H6BrCl2F/c1-4(9)7-5(10)2-3-6(12)8(7)11/h2-4H,1H3 |
| InChIKey | DBEOITYJIRUOBF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.94 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|