C12H15Cl2FO2 — CID 143190128
1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane (PubChem CID 143190128) has the molecular formula C12H15Cl2FO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane.
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane |
|---|---|
| PubChem CID | 143190128 |
| Molecular Formula | C12H15Cl2FO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane |
| SMILES | CC.CC(=O)OC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C10H9Cl2FO2.C2H6/c1-5(15-6(2)14)9-7(11)3-4-8(13)10(9)12;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | PGWMXPZOKMQGNE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|