About 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane
1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane (PubChem CID 143190128) has the molecular formula C12H15Cl2FO2
and a molecular weight of 281.15 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane.
Molecular Properties
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane |
| PubChem CID | 143190128 |
| Molecular Formula | C12H15Cl2FO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane |
| SMILES | CC.CC(=O)OC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C10H9Cl2FO2.C2H6/c1-5(15-6(2)14)9-7(11)3-4-8(13)10(9)12;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | PGWMXPZOKMQGNE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane?
The IUPAC name of 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane (CID 143190128) is 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane.
What is the SMILES notation for 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane?
The canonical SMILES for 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane is CC.CC(=O)OC(C)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane?
The InChIKey is PGWMXPZOKMQGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2FO2.C2H6/c1-5(15-6(2)14)9-7(11)3-4-8(13)10(9)12;1-2/h3-5H,1-2H3;1-2H3.
What are the key properties of 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane?
1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane has a molecular weight of 281.15 g/mol, XLogP of 4.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichloro-3-fluorophenyl)ethyl acetate;ethane is sourced from PubChem (CID 143190128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).