About 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate
1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate (PubChem CID 60584670) has the molecular formula C18H15Cl2FN2O3
and a molecular weight of 397.23 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate.
Molecular Properties
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate |
| PubChem CID | 60584670 |
| Molecular Formula | C18H15Cl2FN2O3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate |
| SMILES | CC(OC(=O)c1ccc(N2CCNC2=O)cc1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C18H15Cl2FN2O3/c1-10(15-13(19)6-7-14(21)16(15)20)26-17(24)11-2-4-12(5-3-11)23-9-8-22-18(23)25/h2-7,10H,8-9H2,1H3,(H,22,25) |
| InChIKey | DDBCOCHAOYREDX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate?
The IUPAC name of 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate (CID 60584670) is 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate.
What is the SMILES notation for 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate?
The canonical SMILES for 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate is CC(OC(=O)c1ccc(N2CCNC2=O)cc1)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate?
The InChIKey is DDBCOCHAOYREDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Cl2FN2O3/c1-10(15-13(19)6-7-14(21)16(15)20)26-17(24)11-2-4-12(5-3-11)23-9-8-22-18(23)25/h2-7,10H,8-9H2,1H3,(H,22,25).
What are the key properties of 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate?
1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate has a molecular weight of 397.23 g/mol, XLogP of 4.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate is sourced from PubChem (CID 60584670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).