C18H15Cl2FN2O3 — CID 60584670
1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate (PubChem CID 60584670) has the molecular formula C18H15Cl2FN2O3 and a molecular weight of 397.23 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate.
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 60584670 |
| Molecular Formula | C18H15Cl2FN2O3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)ethyl 4-(2-oxoimidazolidin-1-yl)benzoate |
| SMILES | CC(OC(=O)c1ccc(N2CCNC2=O)cc1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C18H15Cl2FN2O3/c1-10(15-13(19)6-7-14(21)16(15)20)26-17(24)11-2-4-12(5-3-11)23-9-8-22-18(23)25/h2-7,10H,8-9H2,1H3,(H,22,25) |
| InChIKey | DDBCOCHAOYREDX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|