C19H16F2N2O4 — CID 97020541
[(1R)-1-(2,6-difluorophenyl)ethyl] 4-(3,6-dioxodiazinan-1-yl)benzoate (PubChem CID 97020541) has the molecular formula C19H16F2N2O4 and a molecular weight of 374.34 g/mol. Its IUPAC name is [(1R)-1-(2,6-difluorophenyl)ethyl] 4-(3,6-dioxodiazinan-1-yl)benzoate.
| Compound Name | [(1R)-1-(2,6-difluorophenyl)ethyl] 4-(3,6-dioxodiazinan-1-yl)benzoate |
|---|---|
| PubChem CID | 97020541 |
| Molecular Formula | C19H16F2N2O4 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [(1R)-1-(2,6-difluorophenyl)ethyl] 4-(3,6-dioxodiazinan-1-yl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(N2NC(=O)CCC2=O)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H16F2N2O4/c1-11(18-14(20)3-2-4-15(18)21)27-19(26)12-5-7-13(8-6-12)23-17(25)10-9-16(24)22-23/h2-8,11H,9-10H2,1H3,(H,22,24)/t11-/m1/s1 |
| InChIKey | HUSZULPTUPFRAE-LLVKDONJSA-N |
| XLogP | 3.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |