C17H25ClN4O3 — CID 119666174
N-(1-aminohexan-2-yl)-4-(3,6-dioxodiazinan-1-yl)benzamide;hydrochloride (PubChem CID 119666174) has the molecular formula C17H25ClN4O3 and a molecular weight of 368.87 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-4-(3,6-dioxodiazinan-1-yl)benzamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-4-(3,6-dioxodiazinan-1-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119666174 |
| Molecular Formula | C17H25ClN4O3 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(1-aminohexan-2-yl)-4-(3,6-dioxodiazinan-1-yl)benzamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccc(N2NC(=O)CCC2=O)cc1.Cl |
| InChI | InChI=1S/C17H24N4O3.ClH/c1-2-3-4-13(11-18)19-17(24)12-5-7-14(8-6-12)21-16(23)10-9-15(22)20-21;/h5-8,13H,2-4,9-11,18H2,1H3,(H,19,24)(H,20,22);1H |
| InChIKey | NDADZSUWWVEXSO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |